C26H18N4O3S — CID 17313285
(E)-3-(5-phenylfuran-2-yl)-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]prop-2-enamide (PubChem CID 17313285) has the molecular formula C26H18N4O3S and a molecular weight of 466.52 g/mol. Its IUPAC name is (E)-3-(5-phenylfuran-2-yl)-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(5-phenylfuran-2-yl)-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17313285 |
| Molecular Formula | C26H18N4O3S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (E)-3-(5-phenylfuran-2-yl)-N-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)o1)NC(=S)Nc1ccc2oc(-c3cccnc3)nc2c1 |
| InChI | InChI=1S/C26H18N4O3S/c31-24(13-10-20-9-12-22(32-20)17-5-2-1-3-6-17)30-26(34)28-19-8-11-23-21(15-19)29-25(33-23)18-7-4-14-27-16-18/h1-16H,(H2,28,30,31,34)/b13-10+ |
| InChIKey | ICTAZBMYIPHSIY-JLHYYAGUSA-N |
| XLogP | 5.68 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|