C27H19N3O4S — CID 137153635
(E)-N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide (PubChem CID 137153635) has the molecular formula C27H19N3O4S and a molecular weight of 481.53 g/mol. Its IUPAC name is (E)-N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 137153635 |
| Molecular Formula | C27H19N3O4S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (E)-N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)o1)NC(=S)Nc1ccc(-c2nc3ccccc3o2)c(O)c1 |
| InChI | InChI=1S/C27H19N3O4S/c31-22-16-18(10-13-20(22)26-29-21-8-4-5-9-24(21)34-26)28-27(35)30-25(32)15-12-19-11-14-23(33-19)17-6-2-1-3-7-17/h1-16,31H,(H2,28,30,32,35)/b15-12+ |
| InChIKey | WLGHDNJPMBPWSW-NTCAYCPXSA-N |
| XLogP | 5.99 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|