C31H26Cl2N2O3 — CID 5128252
N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 5128252) has the molecular formula C31H26Cl2N2O3 and a molecular weight of 545.47 g/mol. Its IUPAC name is N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5128252 |
| Molecular Formula | C31H26Cl2N2O3 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(C)c(NC(=O)C=Cc4ccc(-c5cccc(Cl)c5Cl)o4)c3)nc2c1 |
| InChI | InChI=1S/C31H26Cl2N2O3/c1-4-18(2)20-10-13-28-26(16-20)35-31(38-28)21-9-8-19(3)25(17-21)34-29(36)15-12-22-11-14-27(37-22)23-6-5-7-24(32)30(23)33/h5-18H,4H2,1-3H3,(H,34,36) |
| InChIKey | CTEJOITUWVMKFZ-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|