C30H24Cl2N2O3 — CID 17318721
(E)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17318721) has the molecular formula C30H24Cl2N2O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is (E)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17318721 |
| Molecular Formula | C30H24Cl2N2O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | (E)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(NC(=O)/C=C/c4ccc(-c5cc(Cl)cc(Cl)c5)o4)cc3)nc2c1 |
| InChI | InChI=1S/C30H24Cl2N2O3/c1-3-18(2)20-6-11-28-26(16-20)34-30(37-28)19-4-7-24(8-5-19)33-29(35)13-10-25-9-12-27(36-25)21-14-22(31)17-23(32)15-21/h4-18H,3H2,1-2H3,(H,33,35)/b13-10+ |
| InChIKey | PGAVBLOUZHFIHH-JLHYYAGUSA-N |
| XLogP | 9.23 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|