C26H22Cl2N2O2 — CID 27235888
(E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 27235888) has the molecular formula C26H22Cl2N2O2 and a molecular weight of 465.38 g/mol. Its IUPAC name is (E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27235888 |
| Molecular Formula | C26H22Cl2N2O2 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | (E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3cccc(NC(=O)/C=C/c4ccc(Cl)cc4Cl)c3)nc2c1 |
| InChI | InChI=1S/C26H22Cl2N2O2/c1-3-16(2)18-8-11-24-23(14-18)30-26(32-24)19-5-4-6-21(13-19)29-25(31)12-9-17-7-10-20(27)15-22(17)28/h4-16H,3H2,1-2H3,(H,29,31)/b12-9+/t16-/m1/s1 |
| InChIKey | JPFYCZAUAXWCCW-ONOODXEBSA-N |
| XLogP | 7.97 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|