C27H23Cl2N3O2S — CID 98095552
(E)-N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 98095552) has the molecular formula C27H23Cl2N3O2S and a molecular weight of 524.47 g/mol. Its IUPAC name is (E)-N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98095552 |
| Molecular Formula | C27H23Cl2N3O2S |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | (E)-N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3cccc(NC(=S)NC(=O)/C=C/c4ccc(Cl)cc4Cl)c3)nc2c1 |
| InChI | InChI=1S/C27H23Cl2N3O2S/c1-3-16(2)18-8-11-24-23(14-18)31-26(34-24)19-5-4-6-21(13-19)30-27(35)32-25(33)12-9-17-7-10-20(28)15-22(17)29/h4-16H,3H2,1-2H3,(H2,30,32,33,35)/b12-9+/t16-/m0/s1 |
| InChIKey | KKKBNZPXLJDKFD-YHVDPYDOSA-N |
| XLogP | 7.84 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|