C28H26BrN3O3S — CID 98095648
(E)-3-(5-bromo-2-methoxyphenyl)-N-[[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 98095648) has the molecular formula C28H26BrN3O3S and a molecular weight of 564.51 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-[[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 98095648 |
| Molecular Formula | C28H26BrN3O3S |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3cccc(NC(=S)NC(=O)/C=C/c4cc(Br)ccc4OC)c3)nc2c1 |
| InChI | InChI=1S/C28H26BrN3O3S/c1-4-17(2)18-8-11-25-23(16-18)31-27(35-25)20-6-5-7-22(15-20)30-28(36)32-26(33)13-9-19-14-21(29)10-12-24(19)34-3/h5-17H,4H2,1-3H3,(H2,30,32,33,36)/b13-9+/t17-/m1/s1 |
| InChIKey | FCTCNDOOWYCENG-JZUUQJBKSA-N |
| XLogP | 7.31 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|