C23H27N3O2S — CID 40598606
N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-methylbutanamide (PubChem CID 40598606) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 40598606 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-methylbutanamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3cccc(NC(=S)NC(=O)CC(C)C)c3)nc2c1 |
| InChI | InChI=1S/C23H27N3O2S/c1-5-15(4)16-9-10-20-19(13-16)25-22(28-20)17-7-6-8-18(12-17)24-23(29)26-21(27)11-14(2)3/h6-10,12-15H,5,11H2,1-4H3,(H2,24,26,27,29)/t15-/m0/s1 |
| InChIKey | OAXYWIPEKUWLHB-HNNXBMFYSA-N |
| XLogP | 5.87 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|