C31H28N2O2 — CID 27235892
N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-2,2-diphenylacetamide (PubChem CID 27235892) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 27235892 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-2,2-diphenylacetamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3cccc(NC(=O)C(c4ccccc4)c4ccccc4)c3)nc2c1 |
| InChI | InChI=1S/C31H28N2O2/c1-3-21(2)24-17-18-28-27(20-24)33-31(35-28)25-15-10-16-26(19-25)32-30(34)29(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-21,29H,3H2,1-2H3,(H,32,34)/t21-/m1/s1 |
| InChIKey | SJNMUTAHAZAPQK-OAQYLSRUSA-N |
| XLogP | 7.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |