C25H24N2O2 — CID 40613949
N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-methylbenzamide (PubChem CID 40613949) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-methylbenzamide.
| Compound Name | N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 40613949 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-methylbenzamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3cccc(NC(=O)c4cccc(C)c4)c3)nc2c1 |
| InChI | InChI=1S/C25H24N2O2/c1-4-17(3)18-11-12-23-22(15-18)27-25(29-23)20-9-6-10-21(14-20)26-24(28)19-8-5-7-16(2)13-19/h5-15,17H,4H2,1-3H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | QFNRYWNGCCUYMD-QGZVFWFLSA-N |
| XLogP | 6.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |