C25H23ClN2O2 — CID 3923303
N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-methylbenzamide (PubChem CID 3923303) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-methylbenzamide.
| Compound Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3923303 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-methylbenzamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(Cl)c(NC(=O)c4cccc(C)c4)c3)nc2c1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-4-16(3)17-9-11-23-22(13-17)28-25(30-23)19-8-10-20(26)21(14-19)27-24(29)18-7-5-6-15(2)12-18/h5-14,16H,4H2,1-3H3,(H,27,29) |
| InChIKey | FZFGHJWLRQEMPF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |