C31H27ClN2O3 — CID 4998926
N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-phenylmethoxybenzamide (PubChem CID 4998926) has the molecular formula C31H27ClN2O3 and a molecular weight of 511.02 g/mol. Its IUPAC name is N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 4998926 |
| Molecular Formula | C31H27ClN2O3 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-3-phenylmethoxybenzamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(Cl)c(NC(=O)c4cccc(OCc5ccccc5)c4)c3)nc2c1 |
| InChI | InChI=1S/C31H27ClN2O3/c1-3-20(2)22-13-15-29-28(17-22)34-31(37-29)24-12-14-26(32)27(18-24)33-30(35)23-10-7-11-25(16-23)36-19-21-8-5-4-6-9-21/h4-18,20H,3,19H2,1-2H3,(H,33,35) |
| InChIKey | ADKRGEVWOJAWFO-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |