C26H24ClN3O3S — CID 2065779
N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-2-phenoxyacetamide (PubChem CID 2065779) has the molecular formula C26H24ClN3O3S and a molecular weight of 494.02 g/mol. Its IUPAC name is N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 2065779 |
| Molecular Formula | C26H24ClN3O3S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-2-phenoxyacetamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)COc4ccccc4)c3)nc2c1 |
| InChI | InChI=1S/C26H24ClN3O3S/c1-3-16(2)17-10-12-23-22(13-17)28-25(33-23)18-9-11-20(27)21(14-18)29-26(34)30-24(31)15-32-19-7-5-4-6-8-19/h4-14,16H,3,15H2,1-2H3,(H2,29,30,31,34)/t16-/m1/s1 |
| InChIKey | GKWCSASGRXWOGQ-MRXNPFEDSA-N |
| XLogP | 6.55 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|