C23H20ClN3O2S2 — CID 2066781
N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 2066781) has the molecular formula C23H20ClN3O2S2 and a molecular weight of 470.02 g/mol. Its IUPAC name is N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2066781 |
| Molecular Formula | C23H20ClN3O2S2 |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4cccs4)c3)nc2c1 |
| InChI | InChI=1S/C23H20ClN3O2S2/c1-3-13(2)14-7-9-19-18(11-14)25-22(29-19)15-6-8-16(24)17(12-15)26-23(30)27-21(28)20-5-4-10-31-20/h4-13H,3H2,1-2H3,(H2,26,27,28,30)/t13-/m0/s1 |
| InChIKey | XEBDVDWRKXOZMH-ZDUSSCGKSA-N |
| XLogP | 6.85 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|