C28H28ClN3O3S — CID 6590163
N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-4-propoxybenzamide (PubChem CID 6590163) has the molecular formula C28H28ClN3O3S and a molecular weight of 522.07 g/mol. Its IUPAC name is N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-4-propoxybenzamide.
| Compound Name | N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 6590163 |
| Molecular Formula | C28H28ClN3O3S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | N-[[5-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2cc(-c3nc4cc([C@@H](C)CC)ccc4o3)ccc2Cl)cc1 |
| InChI | InChI=1S/C28H28ClN3O3S/c1-4-14-34-21-10-6-18(7-11-21)26(33)32-28(36)31-23-16-20(8-12-22(23)29)27-30-24-15-19(17(3)5-2)9-13-25(24)35-27/h6-13,15-17H,4-5,14H2,1-3H3,(H2,31,32,33,36)/t17-/m0/s1 |
| InChIKey | VGXIMXNLWKIRSJ-KRWDZBQOSA-N |
| XLogP | 7.58 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|