C26H24ClN3O3S — CID 4033001
N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 4033001) has the molecular formula C26H24ClN3O3S and a molecular weight of 494.02 g/mol. Its IUPAC name is N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4033001 |
| Molecular Formula | C26H24ClN3O3S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4ccc(OC)cc4)c3)nc2c1 |
| InChI | InChI=1S/C26H24ClN3O3S/c1-4-15(2)17-8-12-23-22(13-17)28-25(33-23)18-7-11-20(27)21(14-18)29-26(34)30-24(31)16-5-9-19(32-3)10-6-16/h5-15H,4H2,1-3H3,(H2,29,30,31,34) |
| InChIKey | LNIYIQJPQDOSBY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|