C24H16ClF5N2O2 — CID 4175416
N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 4175416) has the molecular formula C24H16ClF5N2O2 and a molecular weight of 494.85 g/mol. Its IUPAC name is N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 4175416 |
| Molecular Formula | C24H16ClF5N2O2 |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(Cl)c(NC(=O)c4c(F)c(F)c(F)c(F)c4F)c3)nc2c1 |
| InChI | InChI=1S/C24H16ClF5N2O2/c1-3-10(2)11-5-7-16-15(8-11)32-24(34-16)12-4-6-13(25)14(9-12)31-23(33)17-18(26)20(28)22(30)21(29)19(17)27/h4-10H,3H2,1-2H3,(H,31,33) |
| InChIKey | RKPPOYZRQLLUST-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|