C25H21ClIN3O2S — CID 5130503
N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide (PubChem CID 5130503) has the molecular formula C25H21ClIN3O2S and a molecular weight of 589.89 g/mol. Its IUPAC name is N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 5130503 |
| Molecular Formula | C25H21ClIN3O2S |
| Molecular Weight | 589.89 g/mol |
| Exact Mass | 589.01 |
| IUPAC Name | N-[[5-(5-butan-2-yl-1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4ccccc4I)c3)nc2c1 |
| InChI | InChI=1S/C25H21ClIN3O2S/c1-3-14(2)15-9-11-22-21(12-15)28-24(32-22)16-8-10-18(26)20(13-16)29-25(33)30-23(31)17-6-4-5-7-19(17)27/h4-14H,3H2,1-2H3,(H2,29,30,31,33) |
| InChIKey | SBQYIYBXZCXYRD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.89 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|