C26H22ClN3O4S — CID 41330051
N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 41330051) has the molecular formula C26H22ClN3O4S and a molecular weight of 508.00 g/mol. Its IUPAC name is N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 41330051 |
| Molecular Formula | C26H22ClN3O4S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | N-[[5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-chlorophenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4ccc5c(c4)OCO5)c3)nc2c1 |
| InChI | InChI=1S/C26H22ClN3O4S/c1-3-14(2)15-5-8-21-20(10-15)28-25(34-21)17-4-7-18(27)19(11-17)29-26(35)30-24(31)16-6-9-22-23(12-16)33-13-32-22/h4-12,14H,3,13H2,1-2H3,(H2,29,30,31,35)/t14-/m1/s1 |
| InChIKey | GPXRHYIBSOPLIL-CQSZACIVSA-N |
| XLogP | 6.52 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|