C23H20N2O2 — CID 2203697
(2R)-N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-phenylbutanamide (PubChem CID 2203697) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (2R)-N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 2203697 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (2R)-N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)Nc1cccc(-c2nc3ccccc3o2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O2/c1-2-19(16-9-4-3-5-10-16)22(26)24-18-12-8-11-17(15-18)23-25-20-13-6-7-14-21(20)27-23/h3-15,19H,2H2,1H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | RPSUAWNAOYPUOR-LJQANCHMSA-N |
| XLogP | 5.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |