C20H20N2OS — CID 7366238
(2R)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-phenylbutanamide (PubChem CID 7366238) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is (2R)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 7366238 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2R)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)Nc1cccc(-c2csc(C)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2OS/c1-3-18(15-8-5-4-6-9-15)20(23)22-17-11-7-10-16(12-17)19-13-24-14(2)21-19/h4-13,18H,3H2,1-2H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | BIJWVJKGNQELKC-GOSISDBHSA-N |
| XLogP | 5.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |