C23H25N3OS — CID 7265295
(2R)-2-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]butanamide (PubChem CID 7265295) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is (2R)-2-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]butanamide.
| Compound Name | (2R)-2-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 7265295 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2R)-2-phenyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]butanamide |
| SMILES | CC[C@@H](C(=O)Nc1cccc(-c2csc(N3CCCC3)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3OS/c1-2-20(17-9-4-3-5-10-17)22(27)24-19-12-8-11-18(15-19)21-16-28-23(25-21)26-13-6-7-14-26/h3-5,8-12,15-16,20H,2,6-7,13-14H2,1H3,(H,24,27)/t20-/m1/s1 |
| InChIKey | UIONKRZHFDALRN-HXUWFJFHSA-N |
| XLogP | 5.54 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |