C21H29N3OS — CID 7411488
(2S)-2-ethyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide (PubChem CID 7411488) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is (2S)-2-ethyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide.
| Compound Name | (2S)-2-ethyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 7411488 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (2S)-2-ethyl-N-[3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)phenyl]hexanamide |
| SMILES | CCCC[C@H](CC)C(=O)Nc1cccc(-c2csc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C21H29N3OS/c1-3-5-9-16(4-2)20(25)22-18-11-8-10-17(14-18)19-15-26-21(23-19)24-12-6-7-13-24/h8,10-11,14-16H,3-7,9,12-13H2,1-2H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | MTEAPWRFINHHNL-INIZCTEOSA-N |
| XLogP | 5.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |