C23H26FN3OS — CID 7415959
(2S)-2-ethyl-N-[3-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]phenyl]hexanamide (PubChem CID 7415959) has the molecular formula C23H26FN3OS and a molecular weight of 411.55 g/mol. Its IUPAC name is (2S)-2-ethyl-N-[3-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]phenyl]hexanamide.
| Compound Name | (2S)-2-ethyl-N-[3-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7415959 |
| Molecular Formula | C23H26FN3OS |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (2S)-2-ethyl-N-[3-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]phenyl]hexanamide |
| SMILES | CCCC[C@H](CC)C(=O)Nc1cccc(-c2csc(Nc3ccccc3F)n2)c1 |
| InChI | InChI=1S/C23H26FN3OS/c1-3-5-9-16(4-2)22(28)25-18-11-8-10-17(14-18)21-15-29-23(27-21)26-20-13-7-6-12-19(20)24/h6-8,10-16H,3-5,9H2,1-2H3,(H,25,28)(H,26,27)/t16-/m0/s1 |
| InChIKey | IIRGVQVXMTYMKM-INIZCTEOSA-N |
| XLogP | 6.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |