C23H26ClN3OS — CID 5216456
N-[3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]phenyl]octanamide (PubChem CID 5216456) has the molecular formula C23H26ClN3OS and a molecular weight of 428.00 g/mol. Its IUPAC name is N-[3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]phenyl]octanamide.
| Compound Name | N-[3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]phenyl]octanamide |
|---|---|
| PubChem CID | 5216456 |
| Molecular Formula | C23H26ClN3OS |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[3-[2-(4-chloroanilino)-1,3-thiazol-4-yl]phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1cccc(-c2csc(Nc3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C23H26ClN3OS/c1-2-3-4-5-6-10-22(28)25-20-9-7-8-17(15-20)21-16-29-23(27-21)26-19-13-11-18(24)12-14-19/h7-9,11-16H,2-6,10H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | ZRYNUUXETLFFCZ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|