C19H19N3OS — CID 935726
N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]butanamide (PubChem CID 935726) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]butanamide.
| Compound Name | N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 935726 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(-c2csc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H19N3OS/c1-2-6-18(23)20-16-11-9-14(10-12-16)17-13-24-19(22-17)21-15-7-4-3-5-8-15/h3-5,7-13H,2,6H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | URCCCAPELCEQNP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |