C20H21N3OS — CID 9356285
N-[4-[2-(benzylamino)-1,3-thiazol-4-yl]phenyl]butanamide (PubChem CID 9356285) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is N-[4-[2-(benzylamino)-1,3-thiazol-4-yl]phenyl]butanamide.
| Compound Name | N-[4-[2-(benzylamino)-1,3-thiazol-4-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 9356285 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[4-[2-(benzylamino)-1,3-thiazol-4-yl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(-c2csc(NCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H21N3OS/c1-2-6-19(24)22-17-11-9-16(10-12-17)18-14-25-20(23-18)21-13-15-7-4-3-5-8-15/h3-5,7-12,14H,2,6,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | WXKVIOLGBLHGMK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |