C20H18N2O2S — CID 8534002
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-oxo-4-phenylbutanamide (PubChem CID 8534002) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 8534002 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-4-oxo-4-phenylbutanamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)CCC(=O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C20H18N2O2S/c1-14-21-18(13-25-14)15-7-9-17(10-8-15)22-20(24)12-11-19(23)16-5-3-2-4-6-16/h2-10,13H,11-12H2,1H3,(H,22,24) |
| InChIKey | HAMXENYZUDRQIO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |