C13H14N2O2S — CID 51239098
2-methoxy-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 51239098) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-methoxy-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 51239098 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-methoxy-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(-c2csc(C)n2)cc1 |
| InChI | InChI=1S/C13H14N2O2S/c1-9-14-12(8-18-9)10-3-5-11(6-4-10)15-13(16)7-17-2/h3-6,8H,7H2,1-2H3,(H,15,16) |
| InChIKey | GYGRLRGAHVCRPU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |