methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate

C12H12N2O2S — CID 108727310

IUPACmethyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate
SMILESCOC(=O)Nc1ccc(-c2csc(C)n2)cc1
InChIInChI=1S/C12H12N2O2S/c1-8-13-11(7-17-8)9-3-5-10(6-4-9)14-12(15)16-2/h3-7H,1-2H3,(H,14,15)
InChIKeyHGAILFXFTKTJTD-UHFFFAOYSA-N
MW248.31 g/mol
LogP3.30
Rot. Bonds2

About methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate

methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate (PubChem CID 108727310) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate.

Molecular Properties

Compound Namemethyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate
PubChem CID108727310
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Namemethyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate
SMILESCOC(=O)Nc1ccc(-c2csc(C)n2)cc1
InChIInChI=1S/C12H12N2O2S/c1-8-13-11(7-17-8)9-3-5-10(6-4-9)14-12(15)16-2/h3-7H,1-2H3,(H,14,15)
InChIKeyHGAILFXFTKTJTD-UHFFFAOYSA-N
XLogP3.30
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate?
The IUPAC name of methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate (CID 108727310) is methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate.
What is the SMILES notation for methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate?
The canonical SMILES for methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate is COC(=O)Nc1ccc(-c2csc(C)n2)cc1.
What is the InChIKey of methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate?
The InChIKey is HGAILFXFTKTJTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-8-13-11(7-17-8)9-3-5-10(6-4-9)14-12(15)16-2/h3-7H,1-2H3,(H,14,15).
What are the key properties of methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate?
methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate has a molecular weight of 248.31 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamate is sourced from PubChem (CID 108727310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).