C20H26N4O3S — CID 99801662
tert-butyl N-[(E)-4-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamoylamino]but-2-enyl]carbamate (PubChem CID 99801662) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamoylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamoylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 99801662 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | tert-butyl N-[(E)-4-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]carbamoylamino]but-2-enyl]carbamate |
| SMILES | Cc1nc(-c2ccc(NC(=O)NC/C=C/CNC(=O)OC(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C20H26N4O3S/c1-14-23-17(13-28-14)15-7-9-16(10-8-15)24-18(25)21-11-5-6-12-22-19(26)27-20(2,3)4/h5-10,13H,11-12H2,1-4H3,(H,22,26)(H2,21,24,25)/b6-5+ |
| InChIKey | GVYYOEZPQISATH-AATRIKPKSA-N |
| XLogP | 4.32 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|