C22H22N4O2S — CID 46545817
2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide (PubChem CID 46545817) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 46545817 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)Cc2ccc(-c3csc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-3-12-23-22(28)26-19-10-8-18(9-11-19)25-21(27)13-16-4-6-17(7-5-16)20-14-29-15(2)24-20/h3-11,14H,1,12-13H2,2H3,(H,25,27)(H2,23,26,28) |
| InChIKey | JGTQYULFMCBVJZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|