C20H23N5OS — CID 108810165
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide (PubChem CID 108810165) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 108810165 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2ccc(-c3csc(C)n3)cc2)n1 |
| InChI | InChI=1S/C20H23N5OS/c1-13-11-14(2)23-20(22-13)21-10-4-5-19(26)25-17-8-6-16(7-9-17)18-12-27-15(3)24-18/h6-9,11-12H,4-5,10H2,1-3H3,(H,25,26)(H,21,22,23) |
| InChIKey | CEDOBIIDCZDNKT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|