C18H22N4O3 — CID 108800716
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide (PubChem CID 108800716) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide |
|---|---|
| PubChem CID | 108800716 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]butanamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C18H22N4O3/c1-12-10-13(2)21-18(20-12)19-7-3-4-17(23)22-14-5-6-15-16(11-14)25-9-8-24-15/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | XXJIPGKKUBTYAT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|