C22H24N2O6 — CID 2930949
N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-yl)hexanediamide (PubChem CID 2930949) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-yl)hexanediamide.
| Compound Name | N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-yl)hexanediamide |
|---|---|
| PubChem CID | 2930949 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N,N'-bis(2,3-dihydro-1,4-benzodioxin-6-yl)hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1ccc2c(c1)OCCO2)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H24N2O6/c25-21(23-15-5-7-17-19(13-15)29-11-9-27-17)3-1-2-4-22(26)24-16-6-8-18-20(14-16)30-12-10-28-18/h5-8,13-14H,1-4,9-12H2,(H,23,25)(H,24,26) |
| InChIKey | ZCNSOMZZMHWFLJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|