C19H24N2O3 — CID 127254983
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-pyrrol-1-ylhexanamide (PubChem CID 127254983) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-pyrrol-1-ylhexanamide.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-pyrrol-1-ylhexanamide |
|---|---|
| PubChem CID | 127254983 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-pyrrol-1-ylhexanamide |
| SMILES | O=C(CCCCCn1cccc1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H24N2O3/c22-19(7-2-1-3-10-21-11-4-5-12-21)20-16-8-9-17-18(15-16)24-14-6-13-23-17/h4-5,8-9,11-12,15H,1-3,6-7,10,13-14H2,(H,20,22) |
| InChIKey | RLNKFBZKNWTYIL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|