C27H32N4O9 — CID 11203720
N',N'-bis[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-hydroxyheptanediamide (PubChem CID 11203720) has the molecular formula C27H32N4O9 and a molecular weight of 556.57 g/mol. Its IUPAC name is N',N'-bis[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-hydroxyheptanediamide.
| Compound Name | N',N'-bis[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-hydroxyheptanediamide |
|---|---|
| PubChem CID | 11203720 |
| Molecular Formula | C27H32N4O9 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | N',N'-bis[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-N-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)N(CC(=O)Nc1ccc2c(c1)OCCO2)CC(=O)Nc1ccc2c(c1)OCCO2)NO |
| InChI | InChI=1S/C27H32N4O9/c32-24(30-36)4-2-1-3-5-27(35)31(16-25(33)28-18-6-8-20-22(14-18)39-12-10-37-20)17-26(34)29-19-7-9-21-23(15-19)40-13-11-38-21/h6-9,14-15,36H,1-5,10-13,16-17H2,(H,28,33)(H,29,34)(H,30,32) |
| InChIKey | BGIRPVJSNZVRBF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 164.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|