C12H14N2O3S — CID 82122796
4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-sulfanylidenebutanamide (PubChem CID 82122796) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-sulfanylidenebutanamide.
| Compound Name | 4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-sulfanylidenebutanamide |
|---|---|
| PubChem CID | 82122796 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-sulfanylidenebutanamide |
| SMILES | NC(=S)CCC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14N2O3S/c13-11(18)3-4-12(15)14-8-1-2-9-10(7-8)17-6-5-16-9/h1-2,7H,3-6H2,(H2,13,18)(H,14,15) |
| InChIKey | LWFXGYRHJOVIPL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|