C13H16N2O4 — CID 82122330
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylbutanediamide (PubChem CID 82122330) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylbutanediamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylbutanediamide |
|---|---|
| PubChem CID | 82122330 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylbutanediamide |
| SMILES | CC(CC(=O)Nc1ccc2c(c1)OCCO2)C(N)=O |
| InChI | InChI=1S/C13H16N2O4/c1-8(13(14)17)6-12(16)15-9-2-3-10-11(7-9)19-5-4-18-10/h2-3,7-8H,4-6H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | QVWOHTFETXZXSD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |