C12H15NO4 — CID 22592459
methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate (PubChem CID 22592459) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate.
| Compound Name | methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate |
|---|---|
| PubChem CID | 22592459 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate |
| SMILES | COC(=O)C(C)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H15NO4/c1-8(12(14)15-2)13-9-3-4-10-11(7-9)17-6-5-16-10/h3-4,7-8,13H,5-6H2,1-2H3 |
| InChIKey | HAZIIZPGGDCQOM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|