methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate

C12H15NO4 — CID 22592459

IUPACmethyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate
SMILESCOC(=O)C(C)Nc1ccc2c(c1)OCCO2
InChIInChI=1S/C12H15NO4/c1-8(12(14)15-2)13-9-3-4-10-11(7-9)17-6-5-16-10/h3-4,7-8,13H,5-6H2,1-2H3
InChIKeyHAZIIZPGGDCQOM-UHFFFAOYSA-N
MW237.25 g/mol
LogP1.43
Rot. Bonds3

About methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate

methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate (PubChem CID 22592459) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate.

Molecular Properties

Compound Namemethyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate
PubChem CID22592459
Molecular FormulaC12H15NO4
Molecular Weight237.25 g/mol
Exact Mass237.10
IUPAC Namemethyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate
SMILESCOC(=O)C(C)Nc1ccc2c(c1)OCCO2
InChIInChI=1S/C12H15NO4/c1-8(12(14)15-2)13-9-3-4-10-11(7-9)17-6-5-16-10/h3-4,7-8,13H,5-6H2,1-2H3
InChIKeyHAZIIZPGGDCQOM-UHFFFAOYSA-N
XLogP1.43
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.25
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}

Analyze methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate?
The IUPAC name of methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate (CID 22592459) is methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate.
What is the SMILES notation for methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate?
The canonical SMILES for methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate is COC(=O)C(C)Nc1ccc2c(c1)OCCO2.
What is the InChIKey of methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate?
The InChIKey is HAZIIZPGGDCQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-8(12(14)15-2)13-9-3-4-10-11(7-9)17-6-5-16-10/h3-4,7-8,13H,5-6H2,1-2H3.
What are the key properties of methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate?
methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate has a molecular weight of 237.25 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanoate is sourced from PubChem (CID 22592459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).