C18H20N2O4 — CID 17436766
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyanilino)propanamide (PubChem CID 17436766) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyanilino)propanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 17436766 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methoxyanilino)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-12(19-13-3-6-15(22-2)7-4-13)18(21)20-14-5-8-16-17(11-14)24-10-9-23-16/h3-8,11-12,19H,9-10H2,1-2H3,(H,20,21) |
| InChIKey | AKCFAEHHDWVDTD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|