C20H24N2O4 — CID 25354189
(2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 25354189) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | (2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 25354189 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)[C@H](C)Nc2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-14(20(23)21-13-15-4-7-17(24-2)8-5-15)22-16-6-9-18-19(12-16)26-11-3-10-25-18/h4-9,12,14,22H,3,10-11,13H2,1-2H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | IZMDRISSIRTSFU-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|