C16H24N2O3 — CID 45282112
N-tert-butyl-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide (PubChem CID 45282112) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-tert-butyl-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide.
| Compound Name | N-tert-butyl-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide |
|---|---|
| PubChem CID | 45282112 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-tert-butyl-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)propanamide |
| SMILES | CC(Nc1ccc2c(c1)OCCCO2)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H24N2O3/c1-11(15(19)18-16(2,3)4)17-12-6-7-13-14(10-12)21-9-5-8-20-13/h6-7,10-11,17H,5,8-9H2,1-4H3,(H,18,19) |
| InChIKey | HAOHFTDWIOLIEY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|