C13H17NO2 — CID 107906314
N-but-3-en-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine (PubChem CID 107906314) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-but-3-en-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
| Compound Name | N-but-3-en-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
|---|---|
| PubChem CID | 107906314 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-but-3-en-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| SMILES | C=CC(C)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H17NO2/c1-3-10(2)14-11-5-6-12-13(9-11)16-8-4-7-15-12/h3,5-6,9-10,14H,1,4,7-8H2,2H3 |
| InChIKey | WELLDNUBZGWCRC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|