C17H27NO2 — CID 43129743
N-octan-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine (PubChem CID 43129743) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-octan-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
| Compound Name | N-octan-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
|---|---|
| PubChem CID | 43129743 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-octan-2-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| SMILES | CCCCCCC(C)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H27NO2/c1-3-4-5-6-8-14(2)18-15-9-10-16-17(13-15)20-12-7-11-19-16/h9-10,13-14,18H,3-8,11-12H2,1-2H3 |
| InChIKey | BNGYUXDYPZJLGW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|