C15H23NO2 — CID 63945872
N-heptan-3-yl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 63945872) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-heptan-3-yl-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-heptan-3-yl-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 63945872 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-heptan-3-yl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CCCCC(CC)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H23NO2/c1-3-5-6-12(4-2)16-13-7-8-14-15(11-13)18-10-9-17-14/h7-8,11-12,16H,3-6,9-10H2,1-2H3 |
| InChIKey | JPVKNFAFBKEWRD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|