C14H17NO2 — CID 113482416
N-pent-1-yn-3-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine (PubChem CID 113482416) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
| Compound Name | N-pent-1-yn-3-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
|---|---|
| PubChem CID | 113482416 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-pent-1-yn-3-yl-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| SMILES | C#CC(CC)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C14H17NO2/c1-3-11(4-2)15-12-6-7-13-14(10-12)17-9-5-8-16-13/h1,6-7,10-11,15H,4-5,8-9H2,2H3 |
| InChIKey | DOPGFTZDSWBTQH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|