C15H23NO2 — CID 43098963
N-(5-methylhexan-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43098963) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-(5-methylhexan-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43098963 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-(5-methylhexan-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC(C)CCC(C)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H23NO2/c1-11(2)4-5-12(3)16-13-6-7-14-15(10-13)18-9-8-17-14/h6-7,10-12,16H,4-5,8-9H2,1-3H3 |
| InChIKey | WYQQESZTFNFTFU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|