C14H19NO4 — CID 5230063
2-(1,3-benzodioxol-5-ylamino)-5-methylhexanoic acid (PubChem CID 5230063) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-5-methylhexanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-5-methylhexanoic acid |
|---|---|
| PubChem CID | 5230063 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-5-methylhexanoic acid |
| SMILES | CC(C)CCC(Nc1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C14H19NO4/c1-9(2)3-5-11(14(16)17)15-10-4-6-12-13(7-10)19-8-18-12/h4,6-7,9,11,15H,3,5,8H2,1-2H3,(H,16,17) |
| InChIKey | IVOAVTFVCWAAJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|