C15H22N2O3 — CID 43112699
2-(1,3-benzodioxol-5-ylamino)-N-(3-methylbutyl)propanamide (PubChem CID 43112699) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(3-methylbutyl)propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 43112699 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N2O3/c1-10(2)6-7-16-15(18)11(3)17-12-4-5-13-14(8-12)20-9-19-13/h4-5,8,10-11,17H,6-7,9H2,1-3H3,(H,16,18) |
| InChIKey | XHYVJDUFXSRLMX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|